PRODUCT Properties
| Melting point: | 126-129 °C |
| Boiling point: | 375.6±21.0 °C(Predicted) |
| Density | 1.714±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Orange to Green |
| InChI | InChI=1S/C13H9I/c14-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13/h1-6,8H,7H2 |
| InChIKey | VNYQUOAQPXGXQO-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2)C2=C1C=C(I)C=C2 |
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H319-H411-H320 |
| Precautionary statements | P264-P305+P351+P338+P337+P313-P391-P501-P273-P305+P351+P338 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | N,Xi |
| Risk Statements | 51/53 |
| Safety Statements | 61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 2 |






