A7257712
Sodium p-toluenesulfinate , 98%, no water , 824-79-3
Synonym(s):
p-Toluenesulfinic acid sodium salt;Sodiumtoluene-4-sulfinate
CAS NO.：824-79-3
Empirical Formula: C7H7NaO2S
Molecular Weight: 178.18
MDL number: MFCD00013136
EINECS: 212-538-5
| Pack Size | Price | Stock | Quantity |
| 25G | RMB23.20 | In Stock |
|
| 100G | RMB41.60 | In Stock |
|
| 250G | RMB95.20 | In Stock |
|
| 500G | RMB180.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| Density | 1.399-1.405 at 20℃ |
| vapor pressure | 0-0.001Pa at 20-50℃ |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| form | Powder |
| color | White to off-white |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Hygroscopic |
| Merck | 14,9532 |
| BRN | 4621454 |
| InChI | InChI=1S/C7H8O2S.Na/c1-6-2-4-7(5-3-6)10(8)9;/h2-5H,1H3,(H,8,9);/q;+1/p-1 |
| InChIKey | KFZUDNZQQCWGKF-UHFFFAOYSA-M |
| SMILES | C1(=CC=C(C)C=C1)S([O-])=O.[Na+] |
| LogP | -0.9 at 23℃ and pH4 |
| Surface tension | 62.9mN/m at 1.004g/L and 20℃ |
| CAS DataBase Reference | 824-79-3(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenesulfinic acid, 4-methyl-, sodium salt (824-79-3) |
Description and Uses
Sodium p-toluenesulfinate can be used as intermediate of pharmaceutical and dispersal dyes, and also can be used as curing agent of grouting material.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P261-P271 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37/39-26 |
| WGK Germany | 2 |
| RTECS | XT4725000 |
| F | 3 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HS Code | 2930 90 98 |
