A7259112
D-Serine methyl ester hydrochloride , 98% , 5874-57-7
CAS NO.:5874-57-7
Empirical Formula: C4H10ClNO3
Molecular Weight: 155.58
MDL number: MFCD00066121
EINECS: 611-745-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB42.40 | In Stock |
|
| 100G | RMB154.40 | In Stock |
|
| 500g | RMB707.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 163-166 °C(lit.) |
| alpha | -4 º (c=4 in ethanol) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Soluble in ethanol and methanol. |
| form | Liquid |
| color | Clear colorless to yellow |
| optical activity | [α]20/D 4°, c = 4 in ethanol |
| Major Application | peptide synthesis |
| InChI | InChI=1/C4H9NO3.ClH/c1-8-4(7)3(5)2-6;/h3,6H,2,5H2,1H3;1H/t3-;/s3 |
| InChIKey | NDBQJIBNNUJNHA-AENDTGMFSA-N |
| SMILES | [C@@H](N)(CO)C(=O)OC.Cl |&1:0,r| |
| CAS DataBase Reference | 5874-57-7(CAS DataBase Reference) |
Description and Uses
D-Serine Methyl Ester Hydrochloride (cas# 5874-57-7) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| HS Code | 29225000 |
| Storage Class | 11 - Combustible Solids |






