A7265227
1-Boc-4-piperidone , 98% , 79099-07-3
Synonym(s):
N-Boc-4-piperidone;tert-Butyl 4-oxo-1-piperidinecarboxylate
CAS NO.：79099-07-3
Empirical Formula: C10H17NO3
Molecular Weight: 199.25
MDL number: MFCD00151800
EINECS: 616-664-5
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 73-77 °C (lit.) |
| Boiling point: | 336.77°C (rough estimate) |
| Density | 1.1249 (rough estimate) |
| refractive index | 1.4610 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Methanol |
| pka | -1.58±0.20(Predicted) |
| form | Crystalline Powder |
| color | White to slightly yellow |
| Water Solubility | slightly soluble |
| BRN | 3650236 |
| InChI | InChI=1S/C10H17NO3/c1-10(2,3)14-9(13)11-6-4-8(12)5-7-11/h4-7H2,1-3H3 |
| InChIKey | ROUYFJUVMYHXFJ-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC(=O)CC1 |
| CAS DataBase Reference | 79099-07-3(CAS DataBase Reference) |
Description and Uses
1-t-Boc-4-piperidone is a compound useful in organic synthesis used in the preparation of (aminoaryl)(benzyloxy)pyridines as potential antitumor agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/38-22-36/37/38-20/21/22 |
| Safety Statements | 37/39-26-36-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
