A1424212
Boc-Gly-O<I>t</I>Bu , ≥98% , 111652-20-1
Synonym(s):
Boc-glycine tert-butyl ester
CAS NO.:111652-20-1
Empirical Formula: C11H21NO4
Molecular Weight: 231.29
MDL number: MFCD00191866
EINECS: 696-236-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.80 | In Stock |
|
| 5G | RMB101.60 | In Stock |
|
| 25G | RMB328.00 | In Stock |
|
| 100g | RMB1061.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 66-68 °C(lit.) |
| Boiling point: | 306.0±25.0 °C(Predicted) |
| Density | 1.023 |
| storage temp. | 2-8°C |
| solubility | very soluble in Methanol |
| form | powder to crystal |
| pka | 11.06±0.46(Predicted) |
| color | White to Almost white |
| Water Solubility | 1.05g/L at 20℃ |
| BRN | 5002580 |
| Major Application | peptide synthesis |
| InChI | 1S/C11H21NO4/c1-10(2,3)15-8(13)7-12-9(14)16-11(4,5)6/h7H2,1-6H3,(H,12,14) |
| InChIKey | ZDKFMHKWZATBMR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CNC(=O)OC(C)(C)C |
| LogP | 2.21 at 25℃ |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H401-H302 |
| Precautionary statements | P264-P270-P301+P312a-P330-P501a |
| Hazard Codes | Xn |
| Risk Statements | 22-51 |
| Safety Statements | 20/21-29/56 |
| WGK Germany | 3 |
| HS Code | 29241990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| REACH Registrations | Active |







