PRODUCT Properties
| Melting point: | 80℃ |
| Boiling point: | 381.9±32.0 °C(Predicted) |
| Density | 1.087±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | Solid |
| pka | 10.70±0.46(Predicted) |
| color | White to off-white |
| InChI | InChI=1S/C12H23NO5/c1-11(2,3)17-9(15)8(7-14)13-10(16)18-12(4,5)6/h8,14H,7H2,1-6H3,(H,13,16)/t8-/m0/s1 |
| InChIKey | NSNZHQVMWJPBPI-QMMMGPOBSA-N |
| SMILES | C(OC(C)(C)C)(=O)[C@H](CO)NC(OC(C)(C)C)=O |
Description and Uses
(S)-tert-Butyl 2-((tert-Butoxycarbonyl)amino)-3-hydroxypropanoate has been used as a reactant in the synthesis of biomembrane-mimic polymers for tissue engineering or bioimplants.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
