A6231912
Fmoc-D-Arg(Pbf)-OH , ≥98% , 187618-60-6
Synonym(s):
Nα-Fmoc-Nω-(2,2,4,6,7-pentamethyldihydrobenzofuran-5-sulfonyl)-D -arginine;Nα-Fmoc-Nω-Pbf-D -arginine;Fmoc-D-Arg(Pbf)-OH;N-α-Fmoc-N G-(2,2,4,6,7-pentamethyldihydrobenzofuran-5-sulfonyl)-D-arginine
CAS NO.:187618-60-6
Empirical Formula: C34H40N4O7S
Molecular Weight: 648.77
MDL number: MFCD00237010
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB28.80 | In Stock |
|
| 5G | RMB101.60 | In Stock |
|
| 25g | RMB448.00 | In Stock |
|
| 100g | RMB1709.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.37±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in water or 1% acetic acid |
| form | powder to crystal |
| pka | 3.83±0.21(Predicted) |
| color | White to Almost white |
| optical activity | 5.2488° (C=1.0031 g/100ml, DMF) |
| BRN | 9537282 |
| InChIKey | HNICLNKVURBTKV-MUUNZHRXSA-N |
| SMILES | C(O)(=O)[C@@H](CCCNC=NNS(C1=C(C)C(C)=C2OC(C)(C)CC2=C1C)(=O)=O)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference | 187618-60-6(CAS DataBase Reference) |
Description and Uses
peptide synthesis



![[2-[2-(Fmoc-amino)ethoxy]ethoxy]acetic acid](https://img.chemicalbook.com/CAS/GIF/166108-71-0.gif)

