A7266312
Sodium dodecanoate , 98%(T) , 629-25-4
Synonym(s):
Dodecanoic acid sodium salt;Lauric acid sodium salt;Sodium laurate
CAS NO.:629-25-4
Empirical Formula: C12H23NaO2
Molecular Weight: 222.3
MDL number: MFCD00041754
EINECS: 211-082-4
| Pack Size | Price | Stock | Quantity |
| 50G | RMB60.00 | In Stock |
|
| 100g | RMB83.20 | In Stock |
|
| 250G | RMB186.40 | In Stock |
|
| 500g | RMB232.80 | In Stock |
|
| 25g | RMB256.00 | In Stock |
|
| 1KG | RMB418.40 | In Stock |
|
| 5kg | RMB1700.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 310℃ |
| Density | 1.102 g/cm3 |
| storage temp. | room temp |
| solubility | almost transparency in EtOH50vol% |
| form | Powder or Flakes |
| color | White to pale yellow |
| Odor | wh. odorless solid |
| biological source | synthetic |
| BRN | 3574124 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong bases, strong acids. May be moisture sensitive. |
| InChI | InChI=1S/C12H24O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;/h2-11H2,1H3,(H,13,14);/q;+1/p-1 |
| InChIKey | BTURAGWYSMTVOW-UHFFFAOYSA-M |
| SMILES | C(CCC([O-])=O)CCCCCCCC.[Na+] |
| LogP | 5.028 (est) |
| CAS DataBase Reference | 629-25-4(CAS DataBase Reference) |
| EPA Substance Registry System | Sodium laurate (629-25-4) |
Description and Uses
Sodium dodecanoate (sodium laurate) is used in cholloidal chemistry as a nonionic surfactant.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P280-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi,N |
| Risk Statements | 37/38-41-51/53-52 |
| Safety Statements | 26-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 1 |
| RTECS | OF0700000 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29159000 |




