A7266612
Sodium methacrylate , 99% , 5536-61-8
Synonym(s):
Methacrylic acid sodium salt
CAS NO.:5536-61-8
Empirical Formula: C4H5NaO2
Molecular Weight: 108.07
MDL number: MFCD00045886
EINECS: 226-896-5
| Pack Size | Price | Stock | Quantity |
| 10g | RMB26.40 | In Stock |
|
| 25G | RMB44.00 | In Stock |
|
| 50G | RMB67.20 | In Stock |
|
| 100G | RMB100.00 | In Stock |
|
| 500g | RMB311.20 | In Stock |
|
| 2.5kg | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 300 °C (lit.) |
| Density | 2,703 g/cm3 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| color | White to Almost white |
| Specific Gravity | 2.703 |
| Water Solubility | Soluble in water. |
| Hydrolytic Sensitivity | 0: forms stable aqueous solutions |
| BRN | 3567418 |
| InChI | InChI=1S/C4H6O2.Na/c1-3(2)4(5)6;/h1H2,2H3,(H,5,6);/q;+1/p-1 |
| InChIKey | SONHXMAHPHADTF-UHFFFAOYSA-M |
| SMILES | C(=C)(C)C([O-])=O.[Na+] |
| CAS DataBase Reference | 5536-61-8(CAS DataBase Reference) |
| EPA Substance Registry System | Sodium methacrylate (5536-61-8) |
Description and Uses
Resins, chemical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2916.13.0000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 5536-61-8(Hazardous Substances Data) |







