A7271412
Sodium hippurate , 97% , 532-94-5
Synonym(s):
Benzoylaminoacetic acid sodium salt;Hippuric acid sodium salt hydrate;N-Benzoylglycine sodium salt
CAS NO.：532-94-5
Empirical Formula: C9H8NNaO3
Molecular Weight: 201.15
MDL number: MFCD00002693
EINECS: 208-548-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB44.00 | In Stock |
|
| 25G | RMB127.20 | In Stock |
|
| 100G | RMB378.40 | In Stock |
|
| 250g | RMB935.20 | In Stock |
|
| 500g | RMB1646.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 240～244℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | H2O: 0.5 M at 20 °C, clear, colorless |
| form | Solid |
| color | White powder |
| Water Solubility | Soluble in water. |
| BRN | 3638470 |
| Major Application | detection |
| InChI | 1S/C9H9NO3.Na.H2O/c11-8(12)6-10-9(13)7-4-2-1-3-5-7;;/h1-5H,6H2,(H,10,13)(H,11,12);;1H2/q;+1;/p-1 |
| InChIKey | IOZRWVOSUXHESF-UHFFFAOYSA-M |
| SMILES | O.[Na+].[O-]C(=O)CNC(=O)c1ccccc1 |
| CAS DataBase Reference | 532-94-5(CAS DataBase Reference) |
| EPA Substance Registry System | Glycine, N-benzoyl-, monosodium salt (532-94-5) |
Description and Uses
Hippuric Acid Sodium Salt can be used for agrobacterium-mediated rice genetic transformation method.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P301+P310-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 24/25-36/37-26-22 |
| WGK Germany | 3 |
| RTECS | MR8170000 |
| TSCA | TSCA listed |
| HS Code | 2924.29.9500 |
| Storage Class | 11 - Combustible Solids |
