A5427712
Methotrexate hydrate , 99% , 59-05-2
Synonym(s):
Methotrexate;MTX;Methotrexate hydrate;Methylaminopterin;Methylaminopterin hydrate
CAS NO.:59-05-2
Empirical Formula: C20H22N8O5
Molecular Weight: 454.45
MDL number: MFCD00064370
EINECS: 200-413-8
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB40.00 | In Stock |
|
| 500MG | RMB71.20 | In Stock |
|
| 1G | RMB97.60 | In Stock |
|
| 5G | RMB307.20 | In Stock |
|
| 25g | RMB1074.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 195°C |
| Boiling point: | 561.26°C (rough estimate) |
| alpha | +17~+24°(D/20℃)(c=1,Na2CO3 soln.)(calculated on the dehydrous basis) |
| Density | 1.4080 (rough estimate) |
| refractive index | 1.6910 (estimate) |
| Flash point: | 11℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility | H2O: insoluble |
| form | powder |
| pka | pKa 3.04/4.99(H2O,t =25,I=0.0025) (Uncertain) |
| color | Light yellow to yellow |
| biological source | synthetic |
| optical activity | Consistent with structure |
| Water Solubility | Insoluble. <0.1 g/100 mL at 19 ºC |
| Sensitive | Light Sensitive & Hygroscopic |
| Merck | 14,5985 |
| BRN | 70669 |
| BCS Class | 3 |
| Stability: | Stable, but light sensitive and hygroscopic. Incompatible with strong acids, strong oxidizing agents. Store at -15C or below. |
| Major Application | pharmaceutical (small molecule) |
| InChIKey | FBOZXECLQNJBKD-ZDUSSCGKSA-N |
| SMILES | CN(Cc1cnc2nc(N)nc(N)c2n1)c3ccc(cc3)C(=O)N[C@@H](CCC(O)=O)C(O)=O |
| CAS DataBase Reference | 59-05-2(CAS DataBase Reference) |
| IARC | 3 (Vol. 26, Sup 7) 1987 |
| NIST Chemistry Reference | Methotrexate(59-05-2) |
| EPA Substance Registry System | Methotrexate (59-05-2) |
Description and Uses
Methotrexate is an orange-brown crystalline powder. Molecular weight= 454.50; Freezing/Melting point=185204℃ (decomposes). Insoluble in water.
Used as a antineoplastic and antirheumatic. A folic Acid antagonist
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H341-H360D |
| Precautionary statements | P201-P301+P310+P330-P302+P352-P305+P351+P338 |
| target organs | Liver,Bone marrow |
| Hazard Codes | T,F |
| Risk Statements | 61-25-36/38-46-39/23/24/25-23/24/25-11 |
| Safety Statements | 53-26-36/37-45-36/37/39-36-16 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | MA1225000 |
| F | 3-8-10 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29335995 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Muta. 2 Repr. 1B STOT RE 1 |
| Hazardous Substances Data | 59-05-2(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: 135mg/kg |







