A0645412
Aminopterin , 98% , 54-62-6
Synonym(s):
Aminopterin;(S)-2-{4-[(2,4-Diaminopteridin-6-yl)methylamino]benzamido}pentanedioic acid;4-Aminofolic acid;4-Amino-PGA;4-Aminopteroyl-L -glutamic acid
CAS NO.:54-62-6
Empirical Formula: C19H20N8O5
Molecular Weight: 440.41
MDL number: MFCD00036692
EINECS: 200-209-9
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB215.20 | In Stock |
|
| 25mg | RMB418.40 | In Stock |
|
| 100mg | RMB1178.40 | In Stock |
|
| 500MG | RMB3999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 225 °C |
| alpha | 18 º (c=1% in 0.1N NaOH) |
| Boiling point: | 551.67°C (rough estimate) |
| Density | 1.4378 (rough estimate) |
| refractive index | 1.6910 (estimate) |
| Flash point: | 87℃ |
| storage temp. | -20°C |
| solubility | 2 M NaOH: 50 mg/mL |
| form | powder |
| pka | pKa 5.5 (Uncertain) |
| color | yellow |
| biological source | synthetic (organic) |
| Water Solubility | 10mL/vial, clear, red (in TC Medium) |
| ε(extinction coefficient) | 24,500 at 282nm in 0.1 M NaOH at 1M 25,700 at 261nm in 0.1 M NaOH at 1M 8,100 at 373nm in 0.1 M NaOH at 1M |
| Merck | 14,472 |
| BRN | 69045 |
| InChIKey | TVZGACDUOSZQKY-UHFFFAOYSA-N |
| SMILES | OC(CC[C@@H](C(O)=O)NC(C1=CC=C(NCC2=NC3=C(N)N=C(N)N=C3N=C2)C=C1)=O)=O |
| CAS DataBase Reference | 54-62-6(CAS DataBase Reference) |
| EPA Substance Registry System | Aminopterin (54-62-6) |
Description and Uses
Aminopterin is an amino derivative of folic acid, which was once used as an antineoplastic agent in the treatment of pediatric leukemia. In the 1950's its production was discontinued in favor of methotrexate, which is less potent but less toxic. Off label, aminopterin has also been used in the treatment of psoriasis. Clinicians need to be aware of the characteristic teratologic effects of aminopterin and methotrexate.
antineoplastic, antirheumatic, folic acid antagonist
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H300-H360 |
| Precautionary statements | P201-P280-P301+P330+P331+P310-P308+P313 |
| Hazard Codes | T+ |
| Risk Statements | 61-28-63-26/27/28 |
| Safety Statements | 53-28-36/37-45-36/37/39-22 |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | MA1050000 |
| F | 8-10-23 |
| TSCA | TSCA listed |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| HS Code | 29339900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Muta. 2 Repr. 1B |
| Hazardous Substances Data | 54-62-6(Hazardous Substances Data) |
| Toxicity | LDLo orl-rat: 2500 mg/kg JPETAB 95,303,49 |







