BD7702531
(2,4-Diaminopteridin-6-yl)methanol , 95% , 945-24-4
Synonym(s):
2,4-Diamino-6-pteridinemethanol
CAS NO.：945-24-4
Empirical Formula: C7H8N6O
Molecular Weight: 192.18
MDL number: MFCD00006711
EINECS: 213-412-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB75.20 | In Stock |
|
| 5g | RMB238.40 | In Stock |
|
| 25g | RMB716.00 | In Stock |
|
| 100g | RMB1791.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 333-334 °C (decomp) |
| Boiling point: | 560.2±60.0 °C(Predicted) |
| Density | 1.673±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| pka | 12.00±0.10(Predicted) |
| color | Light Brown to Dark Yellow |
| InChI | InChI=1S/C7H8N6O/c8-5-4-6(13-7(9)12-5)10-1-3(2-14)11-4/h1,14H,2H2,(H4,8,9,10,12,13) |
| InChIKey | CYNARAWTVHQHDI-UHFFFAOYSA-N |
| SMILES | N1=C2C(N=C(CO)C=N2)=C(N)N=C1N |
| CAS DataBase Reference | 945-24-4(CAS DataBase Reference) |
Description and Uses
2,4-Pteridinediamine-6-methanol (Methotrexate EP Impurity A) is an impurity of Methotrexate. A useful reagent for the development of selective antiparasitic compounds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
