A7277612
D-Sorbitol , Ultra -pure, ≥99.5%(HPLC) , 50-70-4
Synonym(s):
D -Glucitol;D -Sorbitol;D-Glucitol;Parteck Sorbitol
CAS NO.:50-70-4
Empirical Formula: C6H14O6
Molecular Weight: 182.17
MDL number: MFCD00004708
EINECS: 200-061-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB36.00 | In Stock |
|
| 25G | RMB159.20 | In Stock |
|
| 100G | RMB316.00 | In Stock |
|
| 500G | RMB1272.00 | In Stock |
|
| 5KG | RMB7988.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-100 °C (lit.) |
| alpha | 4 º (per eur. pharm.) |
| Boiling point: | bp760 105° |
| Density | 1.28 g/mL at 25 °C |
| bulk density | 450kg/m3 |
| vapor density | <1 (vs air) |
| vapor pressure | <0.1 mm Hg ( 25 °C) |
| refractive index | n |
| FEMA | 3029 | D-SORBITOL |
| Flash point: | >100°C |
| storage temp. | room temp |
| solubility | Very soluble in water, slightly soluble in ethanol |
| form | liquid |
| pka | pKa (17.5°): 13.6 |
| color | White |
| Specific Gravity | 1.28 |
| Odor | Odorless |
| PH Range | 5 - 7 at 182 g/l at 25 °C |
| PH | 5.0-7.0 (25℃, 1M in H2O) |
| Odor Type | caramellic |
| optical activity | [α]20/D 1.5±0.3°, c = 10% in H2O |
| Water Solubility | SOLUBLE |
| Sensitive | Hygroscopic |
| λmax | λ: 260 nm Amax: 0.04 λ: 280 nm Amax: 0.045 |
| Merck | 14,8725 |
| BRN | 1721899 |
| Dielectric constant | 33.5(27℃) |
| Stability: | Stable. Avoid strong oxidizing agents. Protect from moisture. |
| Cosmetics Ingredients Functions | PERFUMING HUMECTANT FRAGRANCE SKIN CONDITIONING |
| InChI | 1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5-,6-/m1/s1 |
| InChIKey | FBPFZTCFMRRESA-JGWLITMVSA-N |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| LogP | -4.67 |
| CAS DataBase Reference | 50-70-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Sorbitol(50-70-4) |
| EPA Substance Registry System | Sorbitol (50-70-4) |
Description and Uses
D-Sorbitol is a sugar alcohol that is naturally found in Toyon berries. D-Sorbitol is used to increase stability of silver nanoparticles and is also used as a sugar substitute.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P501-P261-P270-P271-P264-P280-P362+P364-P301+P312+P330-P302+P352+P312-P304+P340+P312 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 8-36-26-24/25 |
| WGK Germany | 2 |
| RTECS | LZ4290000 |
| F | 3 |
| Autoignition Temperature | 420 °C |
| TSCA | TSCA listed |
| HS Code | 29054491 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 50-70-4(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: 15900 mg/kg |





