A7283312
L-Serine ethyl ester hydrochloride , 99% , 26348-61-8
CAS NO.:26348-61-8
Empirical Formula: C5H12ClNO3
Molecular Weight: 169.61
MDL number: MFCD00012594
EINECS: 247-624-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB25.60 | In Stock |
|
| 25G | RMB67.20 | In Stock |
|
| 100G | RMB237.60 | In Stock |
|
| 500g | RMB1023.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 130-132 °C(lit.) |
| alpha | -5 º (c=2, H2O) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Solid |
| color | White to off-white |
| optical activity | [α]20/D 4.4°, c = 10.2 in ethanol |
| Water Solubility | soluble |
| Sensitive | Hygroscopic |
| BRN | 3562346 |
| Major Application | peptide synthesis |
| InChI | InChI=1/C5H11NO3.ClH/c1-2-9-5(8)4(6)3-7;/h4,7H,2-3,6H2,1H3;1H/t4-;/s3 |
| InChIKey | JZJQCLZQSHLSFB-NDILARRWNA-N |
| SMILES | C(=O)(OCC)[C@@H](N)CO.Cl |&1:5,r| |
| CAS DataBase Reference | 26348-61-8(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29225090 |
| Storage Class | 11 - Combustible Solids |





