4-Sulfamylbenzoic acid , 95% , 138-41-0
Synonym(s):
4-Carboxybenzenesulfonamide;Benzoic acid 4-sulfamide
CAS NO.:138-41-0
Empirical Formula: C7H7NO4S
Molecular Weight: 201.2
MDL number: MFCD00007938
EINECS: 205-327-4
| Pack Size | Price | Stock | Quantity |
| 25G | RMB46.40 | In Stock |
|
| 100G | RMB126.40 | In Stock |
|
| 250g | RMB247.20 | In Stock |
|
| 500G | RMB467.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 285-295 °C (lit.) |
| Boiling point: | 449.0±47.0 °C(Predicted) |
| Density | 1.5083 (rough estimate) |
| refractive index | 1.6100 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 0.5g/l |
| form | Powder |
| pka | 3.50(at 25℃) |
| color | White |
| Water Solubility | 453 mg/L (25 ºC) |
| Merck | 14,1876 |
| BRN | 1875393 |
| InChI | 1S/C7H7NO4S/c8-13(11,12)6-3-1-5(2-4-6)7(9)10/h1-4H,(H,9,10)(H2,8,11,12) |
| InChIKey | UCAGLBKTLXCODC-UHFFFAOYSA-N |
| SMILES | O=S(C(C=C1)=CC=C1C(O)=O)(N)=O |
| CAS DataBase Reference | 138-41-0(CAS DataBase Reference) |
| NIST Chemistry Reference | P-sulfamoylbenzoic acid(138-41-0) |
| EPA Substance Registry System | 4-Aminosulfonylbenzoic acid (138-41-0) |
Description and Uses
4-Sulfamoylbenzoic acid is a significant class of compounds extensively investigated for their potential applications across various disciplines. Characterized by a nitrogen-containing ring structure, 4-Sulfamoylbenzoic acid is a heterocyclic compound adorned with diverse substituents encircling the ring. Within the body, 4-Sulfamoylbenzoic acid is an agonist for several receptors, including those for serotonin and dopamine. By forming connections with these receptors, 4-Sulfamoylbenzoic acid proficiently modulates their functionality, consequently inducing changes in receptor behavior. This, in turn, precipitates an array of effects contingent upon the specific receptor and the studied drug.
4-Sulfamoylbenzoic Acid (Carzenide) is used as a reagent in the synthesis of carbonic anhydrase inhibitors anticonvulsant agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 22-24/25-36/37/39-26-36 |
| WGK Germany | 3 |
| RTECS | DH6820000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 i.p. in rats: 350 ± 22 mg/kg (Appenroth, Brunlich) |





