A7289212
Sodium anthraquinone-2-sulfonate , 97% , 131-08-8
Synonym(s):
9,10-Dihydro-9,10-dioxo-2-anthracenesulfonic acid sodium salt;Anthraquinone-2-sulfonic acid sodium salt
CAS NO.:131-08-8
Empirical Formula: C14H9NaO5S
Molecular Weight: 312.27
MDL number: MFCD00001229
EINECS: 205-009-5
| Pack Size | Price | Stock | Quantity |
| 25G | RMB79.20 | In Stock |
|
| 100G | RMB215.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| Density | 1.66[at 20℃] |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Store below +30°C. |
| form | powder |
| Appearance | Off-white to light yellow Solid |
| Water Solubility | Soluble in hot water, cold water and insoluble in alcohol or ether. |
| BRN | 3580452 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C14H8O5S.Na.H/c15-13-9-3-1-2-4-10(9)14(16)12-7-8(20(17,18)19)5-6-11(12)13;;/h1-7H,(H,17,18,19);; |
| InChIKey | OOYZSHREGVYLQK-UHFFFAOYSA-N |
| SMILES | O=C1C2=CC=CC=C2C(=O)C2C=CC(S(O)(=O)=O)=CC1=2.[NaH] |
| LogP | -1.6 at 25℃ |
| CAS DataBase Reference | 131-08-8(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Anthracenesulfonic acid, 9,10-dihydro-9,10-dioxo-, sodium salt (131-08-8) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | CB1095550 |
| TSCA | TSCA listed |
| HS Code | 29147090 |




