A7289512
Sulfadiazine sodium salt , 98% , 547-32-0
Synonym(s):
4-Amino-N-(2-pyrimidinyl)benzenesulfonamide sodium salt;SPS Agar Supplement
CAS NO.：547-32-0
Empirical Formula: C10H9N4NaO2S
Molecular Weight: 272.26
MDL number: MFCD00067333
EINECS: 208-919-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB28.80 | In Stock |
|
| 25G | RMB65.60 | In Stock |
|
| 100G | RMB218.40 | In Stock |
|
| 500g | RMB655.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| BRN | 4068213 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C10H10N4O2S.Na.H/c11-8-2-4-9(5-3-8)17(15,16)14-10-12-6-1-7-13-10;;/h1-7H,11H2,(H,12,13,14);; |
| InChIKey | JLDCNMJPBBKAHH-UHFFFAOYSA-N |
| SMILES | S(C1C=CC(N)=CC=1)(=O)(=O)NC1=NC=CC=N1.[NaH] |
| CAS DataBase Reference | 547-32-0(CAS DataBase Reference) |
Description and Uses
Sulfadiazine may be used as an internal standard for the determination of sulfapyridine in biological samples using high-performance liquid chromatography technique.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H411 |
| Precautionary statements | P273-P301+P312+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38-42/43 |
| Safety Statements | 22-26-36/37-45 |
| RIDADR | 3249 |
| WGK Germany | 3 |
| RTECS | WP2000000 |
| F | 10-21 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
