A7328512
Sulfamethoxypyridazine , Analysis standard , 80-35-3
Synonym(s):
N1-(6-Methoxy-d3-3-pyridazinyl)sulfanilamide;N1-(6-Methoxypyridazin-3-yl)sulfanilamide;4-Amino-N-(6-methoxy-d3-3-pyridazinyl)benzenesulfonamide
CAS NO.:80-35-3
Empirical Formula: C11H12N4O3S
Molecular Weight: 280.3
MDL number: MFCD00057372
EINECS: 201-272-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB127.20 | In Stock |
|
| 1G | RMB263.20 | In Stock |
|
| 5g | RMB631.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 182-183° |
| Boiling point: | 564.9±60.0 °C(Predicted) |
| Density | 1.3936 (rough estimate) |
| refractive index | 1.6200 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Crystalline Powder |
| pka | 6.7(at 25℃) |
| color | White to yellow |
| Water Solubility | 579.5mg/L(25 ºC) |
| Merck | 14,8919 |
| BRN | 277076 |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | InChI=1S/C11H12N4O3S/c1-18-11-7-6-10(13-14-11)15-19(16,17)9-4-2-8(12)3-5-9/h2-7H,12H2,1H3,(H,13,15) |
| InChIKey | VLYWMPOKSSWJAL-UHFFFAOYSA-N |
| SMILES | C1(S(NC2=NN=C(OC)C=C2)(=O)=O)=CC=C(N)C=C1 |
| CAS DataBase Reference | 80-35-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Pyridazine, sulfamethoxy-(80-35-3) |
Description and Uses
Sulfamethoxypyridazine is a long-acting sulfonamide antibiotic with anti-inflammatory and antibacterial effects, mainly used for streptococcus, staphylococcus, Escherichia coli and other infections, especially for urinary tract infections.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H317-H334 |
| Precautionary statements | P261-P272-P280-P284-P302+P352-P333+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 37/38-41 |
| Safety Statements | 26-39 |
| WGK Germany | 2 |
| RTECS | WP0400000 |
| F | 10 |
| HS Code | 29350090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Resp. Sens. 1 Skin Sens. 1 |
| Toxicity | LD50 orally in mice: 1750 mg/kg, (Seki) |







