A7315512
5-Sulfosalicylic acid dihydrate , Dedicated by electrophoresis, ≥99% , 5965-83-3
Synonym(s):
2-Hydroxy-5-sulfobenzoic acid;5-Sulfosalicylic acid dihydrate;Salicylsulfonic acid
CAS NO.:5965-83-3
Empirical Formula: C7H10O8S
Molecular Weight: 254.21
MDL number: MFCD00149540
EINECS: 641-618-6
| Pack Size | Price | Stock | Quantity |
| 100G | RMB191.20 | In Stock |
|
| 500G | RMB671.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 105-110 °C(lit.) |
| Boiling point: | 100 °C |
| Density | 0,8 g/cm3 |
| bulk density | 310kg/m3 |
| vapor density | 0.62 (vs air) |
| vapor pressure | <1 hPa (20 °C) |
| Flash point: | 150°C |
| storage temp. | Store below +30°C. |
| solubility | H2O: 1 M at 20 °C, clear, colorless |
| form | Powder |
| color | White |
| Odor | Odorless |
| PH | <0.5 (200g/l, H2O, 20℃) |
| Water Solubility | SOLUBLE |
| Sensitive | Light Sensitive |
| Merck | 14,8964 |
| BRN | 650741 |
| Stability: | Stable, but light sensitive. Incompatible with strong oxidizing agents. |
| InChI | 1S/C7H6O6S.2H2O/c8-6-2-1-4(14(11,12)13)3-5(6)7(9)10;;/h1-3,8H,(H,9,10)(H,11,12,13);2*1H2 |
| InChIKey | BHDKTFQBRFWJKR-UHFFFAOYSA-N |
| SMILES | [H]O[H].[H]O[H].OC(=O)c1cc(ccc1O)S(O)(=O)=O |
| CAS DataBase Reference | 5965-83-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 2-hydroxy-5-sulfo-, dihydrate(5965-83-3) |
| EPA Substance Registry System | Benzoic acid, 2-hydroxy-5-sulfo-, dihydrate (5965-83-3) |
Description and Uses
5-Sulfosalicylic acid dihydrate may be used in the preparation of 1:1 proton-transfer organic adduct, 3-aminopyridin-ium 3-carb-oxy-4-hydroxy-benzene-sulfonate monohydrate and the anhydrous adduct.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P301+P330+P331-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,C,Xi |
| Risk Statements | 22-36/37/38-34 |
| Safety Statements | 26-45-36/37/39-36 |
| RIDADR | UN 3261 8 / PGII |
| WGK Germany | 3 |
| RTECS | VO6500000 |
| F | 8 |
| TSCA | Yes |
| HS Code | 2918 29 00 |
| HazardClass | 8 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Toxicity | LD50 orally in Rabbit: 1850 mg/kg |



