A7315812
Sucrose , Ultra -pure purity ≥99.9%; RNASE, DNASEFREE , 57-50-1
Synonym(s):
Sucrose;Sugar;α-D -Glc-(1→2)-β-D -Fru;α-D -Glucopyranosyl β-D -fructofuranoside;β-D -Fructofuranosyl-α-D -glucopyranoside
CAS NO.:57-50-1
Empirical Formula: C12H22O11
Molecular Weight: 342.3
MDL number: MFCD00006626
EINECS: 200-334-9
| Pack Size | Price | Stock | Quantity |
| 100g | RMB111.20 | In Stock |
|
| 500G | RMB167.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 185-187 °C (lit.) |
| Boiling point: | 397.76°C (rough estimate) |
| alpha | 67 º (c=26, in water 25 ºC) |
| Density | 1.5805 |
| bulk density | 800-950kg/m3 |
| refractive index | 66.5 ° (C=26, H2O) |
| Flash point: | 93.3°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | H2O: 500 mg/mL |
| form | Liquid |
| pka | 12.7(at 25℃) |
| color | White |
| PH | 5.0-7.0 (25℃, 1M in H2O) |
| Odor | Odorless |
| PH Range | 5.5 - 7 at 342 g/l at 25 °C |
| optical activity | [α]25/D +66.3 to +66.8°(lit.) |
| biological source | sugar cane |
| Water Solubility | 1970 g/L (15 ºC) |
| λmax | λ: 260 nm Amax: 0.11 λ: 280 nm Amax: 0.08 |
| Merck | 14,8881 |
| BRN | 90825 |
| Exposure limits | ACGIH: TWA 10 mg/m3 OSHA: TWA 15 mg/m3; TWA 5 mg/m3 NIOSH: TWA 10 mg/m3; TWA 5 mg/m3 |
| Dielectric constant | 3.3(Ambient) |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. Hydrolyzed by dilute acids and by invertase. |
| Cosmetics Ingredients Functions | HUMECTANT SKIN CONDITIONING SOOTHING |
| InChI | 1S/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20H,1-3H2/t4-,5-,6-,7-,8+,9-,10+,11-,12+/m1/s1 |
| InChIKey | CZMRCDWAGMRECN-UGDNZRGBSA-N |
| SMILES | OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| LogP | -4.492 (est) |
| CAS DataBase Reference | 57-50-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Sucrose(57-50-1) |
| EPA Substance Registry System | Sucrose (57-50-1) |
| Absorption | ≤0.100 at 280nm ≤0.120 at 260nm |
Description and Uses
Yuanzhen sugar is a polysaccharide polymer, containing a certain amount of fructooligosaccharides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-37/39-26 |
| OEB | B |
| OEL | TWA: 10 mg/m3 (total) |
| WGK Germany | 2 |
| RTECS | WN6500000 |
| F | 3 |
| TSCA | TSCA listed |
| HS Code | 17019910 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 57-50-1(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: 29700 mg/kg |






