A0712212
D-(+)-Sucrose octaacetate , 98% , 126-14-7
Synonym(s):
Sucrose octaacetate;SOA;D -(+)-Sucrose octaacetate;D-(+)-Saccharose octaacetate;Octa-O-acetylsucrose
CAS NO.:126-14-7
Empirical Formula: C28H38O19
Molecular Weight: 678.59
MDL number: MFCD00006623
EINECS: 204-772-1
| Pack Size | Price | Stock | Quantity |
| 25G | RMB25.60 | In Stock |
|
| 100G | RMB42.40 | In Stock |
|
| 500G | RMB149.60 | In Stock |
|
| 2.5kg | RMB501.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 82-85 °C(lit.) |
| alpha | D25.4 +58.5° (c = 2.56 in abs alcohol) |
| Boiling point: | 260 °C(lit.) |
| Density | 1.28 |
| FEMA | 3038 | SUCROSE OCTAACETATE |
| refractive index | 60 ° (C=2, EtOH) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| form | Powder |
| color | White to creamy white |
| Odor | odorless |
| Odor Type | odorless |
| optical activity | [α]22/D +58.8°, c = 2.5 in ethanol |
| Water Solubility | SLIGHTLY SOLUBLE |
| Merck | 14,8881 |
| BRN | 79290 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | DENATURANT FRAGRANCE |
| InChIKey | ZIJKGAXBCRWEOL-SAXBRCJISA-N |
| SMILES | CC(=O)OC[C@H]1O[C@H](O[C@]2(COC(C)=O)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]2OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| LogP | 3.19 |
| CAS DataBase Reference | 126-14-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Sucrose, octaacetate(126-14-7) |
| EPA Substance Registry System | Sucrose octaacetate (126-14-7) |
Description and Uses
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-37/39-26 |
| WGK Germany | 2 |
| RTECS | WN6620000 |
| F | 3 |
| TSCA | TSCA listed |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 orally in Rabbit: 5000 mg/kg LD50 dermal Rabbit 5000 mg/kg |
| REACH Registrations | Active |



