A7327312
Sulfacetamide , Analysis standard , 144-80-9
Synonym(s):
N-(4-Aminobenzenesulfonyl)acetamide;N-(4-Aminophenylsulfonyl)acetamide;N1-Acetylsulfanilamide;Sulfacetamide
CAS NO.:144-80-9
Empirical Formula: C8H10N2O3S
Molecular Weight: 214.24
MDL number: MFCD00066501
EINECS: 205-640-6
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB295.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 182-184 °C |
| Density | 1.3844 (rough estimate) |
| refractive index | 1.5690 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | ethanol: soluble50mg/mL |
| pka | pKa 1.76±0.04(H2O
t = 25
I = 0.15 (KCl)
Ar atmosphere)(Approximate);5.22±0.01(H2O
t = 25
I = 0.15 (KCl)
Ar atmosphere)(Approximate) |
| form | powder |
| color | white to off-white |
| Water Solubility | <0.01 g/100 mL at 16 ºC |
| Merck | 14,8899 |
| BRN | 981718 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases, strong reducing agents, strong acids. |
| Major Application | clinical testing |
| InChI | 1S/C8H10N2O3S/c1-6(11)10-14(12,13)8-4-2-7(9)3-5-8/h2-5H,9H2,1H3,(H,10,11) |
| InChIKey | SKIVFJLNDNKQPD-UHFFFAOYSA-N |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(N)cc1 |
| CAS DataBase Reference | 144-80-9(CAS DataBase Reference) |
| NIST Chemistry Reference | N-(p-Aminobenzenesulfonyl)acetamide(144-80-9) |
| EPA Substance Registry System | Sulfacetamide (144-80-9) |
Description and Uses
Sulfacetamide is an antibiotic used for the treatment of skin infections and urinary tract infections. Sulfacetamide is also used to treat acne and seborrheic dermatitis. Sulfacetamide was investigated for potential anti-inflammatory properties
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H335 |
| Precautionary statements | P261-P271-P272-P280-P302+P352-P304+P340+P312 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 2 |
| RTECS | AC8450000 |
| TSCA | TSCA listed |
| HS Code | 29350090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 STOT SE 3 |
| Toxicity | LD50 orally in dogs: 8000 mg/kg (Fisher) |




