A7328712
Sulfamoxole , Analysis standard , 729-99-7
Synonym(s):
4-Amino-N-(4,5-dimethyl-2-oxazolyl)benzenesulfonamide;N1-(4,5-Dimethyloxazol-2-yl)sulfanilamide
CAS NO.：729-99-7
Empirical Formula: C11H13N3O3S
Molecular Weight: 267.3
MDL number: MFCD00005303
EINECS: 211-982-7
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB479.20 | In Stock |
|
| 100mg | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 197-199℃ |
| Boiling point: | 481.0±47.0 °C(Predicted) |
| Density | 1.3786 g/cm3 |
| refractive index | 1.6630 (estimate) |
| storage temp. | Refrigerator, Under Inert Atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | pKa 7.40 (Uncertain) |
| color | Off-White to Pale Yellow |
| Water Solubility | 961mg/L(20 ºC) |
| Merck | 13,9009 |
| BRN | 248434 |
| InChI | InChI=1S/C11H13N3O3S/c1-7-8(2)17-11(13-7)14-18(15,16)10-5-3-9(12)4-6-10/h3-6H,12H2,1-2H3,(H,13,14) |
| InChIKey | CYFLXLSBHQBMFT-UHFFFAOYSA-N |
| SMILES | C1(S(NC2=NC(C)=C(C)O2)(=O)=O)=CC=C(N)C=C1 |
Description and Uses
Silversulfadiazine and Sulfamoxol are common drugs in treatment of bacterial disease.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P261-P272-P280-P302+P352-P333+P313-P362+P364 |
| Hazard Codes | Xi |
| Risk Statements | 43 |
| Safety Statements | 36/37 |
| WGK Germany | 2 |
| RTECS | WO9150000 |
| Toxicity | LD50 in mice, rats (g/kg): >10.0, >12.5 orally; 1.80, ~2.50 i.p. (Lagler) |
