A7329712
Silvex solution , Analysis standard , 93-72-1
Synonym(s):
2-(2,4,5-Trichlorophenoxy)propionic acid;2-(2,4,5-Trichlorophenoxy)propionic acid solution;2,4,5-TP;Fenoprop;Silvex
CAS NO.:93-72-1
Empirical Formula: C9H7Cl3O3
Molecular Weight: 269.51
MDL number: MFCD00002646
EINECS: 202-271-2
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 175-180 °C |
| Boiling point: | 378.87°C (rough estimate) |
| Density | 1.5288 (rough estimate) |
| refractive index | 1.4900 (estimate) |
| Flash point: | 11 °C |
| storage temp. | 0-6°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 2.93±0.10(Predicted) |
| Water Solubility | 71mg/L(25 ºC) |
| Merck | 13,8606 |
| BRN | 1985768 |
| Stability: | Stablr. Incompatible with strong bases, strong oxidizing agents. |
| Major Application | agriculture environmental |
| InChI | 1S/C9H7Cl3O3/c1-4(9(13)14)15-8-3-6(11)5(10)2-7(8)12/h2-4H,1H3,(H,13,14) |
| InChIKey | ZLSWBLPERHFHIS-UHFFFAOYSA-N |
| SMILES | CC(Oc1cc(Cl)c(Cl)cc1Cl)C(O)=O |
| CAS DataBase Reference | 93-72-1(CAS DataBase Reference) |
| EPA Substance Registry System | Silvex (93-72-1) |
Description and Uses
Silvex was formerly used as a herbicide. Itsuse in rice fields, sugarcane, and orchards hasbeen stopped by the EPA.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() ![]() GHS02,GHS06,GHS08,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H400-H225-H301+H311+H331-H370-H411-H302-H315-H410 |
| Precautionary statements | P264-P280g-P301+P312a-P321-P332+P313-P501a-P210-P260-P273-P280-P301+P310-P311-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,N,T,F |
| Risk Statements | 22-38-50/53-39/23/24/25-23/24/25-52/53-11 |
| Safety Statements | 37-60-61-45-36/37-16-7 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | UF8225000 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29189990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Irrit. 2 |
| Hazardous Substances Data | 93-72-1(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: 650 mg/kg (Bailey, White) |










