A7333212
(S,S)-(+)-N,N′-Dimethyl-1,2-cyclohexanediamine , 98% , 87583-89-9
Synonym(s):
(S,S)-N,N′-Dimethyl-1,2-diaminocyclohexane;(1S)-trans-1,2-Bis(methylamino)cyclohexane
CAS NO.:87583-89-9
Empirical Formula: C8H18N2
Molecular Weight: 142.24
MDL number: MFCD00671528
EINECS: 625-342-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB30.40 | In Stock |
|
| 1G | RMB44.00 | In Stock |
|
| 5g | RMB110.40 | In Stock |
|
| 25g | RMB390.40 | In Stock |
|
| 100g | RMB1527.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 39-44 °C |
| Boiling point: | 186.8±8.0 °C(Predicted) |
| alpha | 145 º (c=4.47 in chloroform) |
| Density | 0.902 |
| refractive index | 145 ° (C=4, CHCl3) |
| Flash point: | 74 °C |
| storage temp. | 2-8°C |
| pka | 11.04±0.40(Predicted) |
| form | Solid |
| color | Pale brown |
| optical activity | [α]/D +145±5°, c = 4.47 in chloroform |
| Water Solubility | Slightly soluble in water. |
| BRN | 4304824 |
| InChI | InChI=1S/C8H18N2/c1-9-7-5-3-4-6-8(7)10-2/h7-10H,3-6H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | JRHPOFJADXHYBR-YUMQZZPRSA-N |
| SMILES | [C@H]1(NC)CCCC[C@@H]1NC |
| CAS DataBase Reference | 87583-89-9(CAS DataBase Reference) |
Description and Uses
(S,S)-(+)-N,N′-Dimethyl-1,2-cyclohexanediamine can be used:
- To synthesize derivatives of α-diazophosphonic acid, which are employed in O-H and N-H insertion reactions.
- As a starting material for the synthesis of α-chloro-α-alkylphosphonic acids.
- To prepare C2 symmetrical diamine enantiomers of C60 with chirospectrosopic properties.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P260-P270-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 36/37/38-34-22 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3259 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | Ⅱ |
| HS Code | 29213000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Skin Corr. 1B |






