A7337112
DL-Serine methyl ester hydrochloride , 98% , 5619-04-5
CAS NO.：5619-04-5
Empirical Formula: C4H10ClNO3
Molecular Weight: 155.58
MDL number: MFCD00012593
EINECS: 227-047-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.80 | In Stock |
|
| 25G | RMB36.80 | In Stock |
|
| 100G | RMB133.60 | In Stock |
|
| 500g | RMB599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 134-136 °C(lit.) |
| Density | 1.37g/cm3 at 20℃ |
| storage temp. | -20°C |
| solubility | Methanol, Water |
| form | Solid |
| color | White to Off-White |
| Sensitive | Moisture Sensitive |
| BRN | 6067970 |
| InChI | InChI=1S/C4H9NO3.ClH/c1-8-4(7)3(5)2-6;/h3,6H,2,5H2,1H3;1H |
| InChIKey | NDBQJIBNNUJNHA-UHFFFAOYSA-N |
| SMILES | C(N)(CO)C(=O)OC.Cl |
| LogP | -2 at 20℃ and pH7 |
| Surface tension | 76mN/m at 1g/L and 20℃ |
| CAS DataBase Reference | 5619-04-5(CAS DataBase Reference) |
Description and Uses
D,L-Serine Methyl Ester Hydrochloride is used as a reactant in the preparation of chicoric acid analogs as HIV-1 integrase inhibitors. Also used in the total synthesis of (-)-Hennoxazole A.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| HS Code | 29225000 |
