A7343412
Boc-Sar-OH , 98% , 13734-36-6
Synonym(s):
Boc-N-methylglycine;Boc-sarcosine;Boc-Sar-OH;N-α-t.-Boc-sarcosine
CAS NO.:13734-36-6
Empirical Formula: C8H15NO4
Molecular Weight: 189.21
MDL number: MFCD00037795
EINECS: 237-306-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB80.80 | In Stock |
|
| 100G | RMB225.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 88-90 °C |
| Boiling point: | 324.46°C (rough estimate) |
| Density | 1.2321 (rough estimate) |
| refractive index | 1.4540 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), DMSO (Sparingly), Methanol (Slightly) |
| pka | 4.03±0.10(Predicted) |
| form | Crystals or Crystalline Powder |
| color | White |
| BRN | 2046827 |
| Stability: | Hygroscopic |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C8H15NO4/c1-8(2,3)13-7(12)9(4)5-6(10)11/h5H2,1-4H3,(H,10,11) |
| InChIKey | YRXIMPFOTQVOHG-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CN(C(OC(C)(C)C)=O)C |
| CAS DataBase Reference | 13734-36-6(CAS DataBase Reference) |
| EPA Substance Registry System | Glycine, N-[(1,1-dimethylethoxy)carbonyl]-N-methyl- (13734-36-6) |
Description and Uses
Boc-N-methylglycine is used in the preparation of Clavatustide A (C563723) and Clavatustide B (C563725), which have been shown to suppress the proliferation of human hepatocellular carcinoma cells under specific conditions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 21 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29241990 |
| Storage Class | 11 - Combustible Solids |







