A1709512
Boc-3,4-Dehydro-<SC>L</SC>-proline , 95% , 51154-06-4
Synonym(s):
Boc-3,4-dehydro-Pro-OH;N-α-t.-Boc-3,4-dehydro-L-proline
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB162.40 | In Stock |
|
| 500mg | RMB415.20 | In Stock |
|
| 1g | RMB820.00 | In Stock |
|
| 5g | RMB2471.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-95℃ |
| Boiling point: | 336.4±42.0 °C(Predicted) |
| Density | 1.236 |
| storage temp. | 2-8°C |
| form | powder |
| pka | 3.70±0.20(Predicted) |
| color | white |
| Major Application | peptide synthesis |
| InChI | 1S/C10H15NO4/c1-10(2,3)15-9(14)11-6-4-5-7(11)8(12)13/h4-5,7H,6H2,1-3H3,(H,12,13)/t7-/m0/s1 |
| InChIKey | BMIGSRMSSCUMAZ-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC=C[C@H]1C(O)=O |
Description and Uses
Boc-3,4-Dehydro-L-Proline is an N-terminal protected 3,4-Dehydro-L-proline. It is used in solid-phase peptide synthesis (SPPS) to make peptides. 3,4-Dehydro-L-proline is a alternate substrate of the amino acid oxidase, NikD.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H319-H400 |
| Precautionary statements | P273-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,N |
| Risk Statements | 36-50 |
| Safety Statements | 26-60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HS Code | 2933 99 80 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |








