BD0650345
Boc-N-Ethylglycine , 97% , 149794-10-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB32.80 | In Stock |
|
| 1g | RMB41.60 | In Stock |
|
| 5g | RMB174.40 | In Stock |
|
| 10g | RMB324.80 | In Stock |
|
| 25g | RMB742.40 | In Stock |
|
| 100g | RMB1469.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 87-88℃ |
| Boiling point: | 302.7±21.0 °C(Predicted) |
| Density | 1.113±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| form | lumpy crystalline powder |
| pka | 4.03±0.10(Predicted) |
| color | Off white to faint lemon |
| InChI | InChI=1S/C9H17NO4/c1-5-10(6-7(11)12)8(13)14-9(2,3)4/h5-6H2,1-4H3,(H,11,12) |
| InChIKey | SPBIXXXFDSLALC-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CN(C(OC(C)(C)C)=O)CC |
Description and Uses
N-Boc-N-ethyl Glycine, is a substituted Glycine (G615990) used as a building block for the synthesis of more complex pharmaceutical compounds. It can be used for designing potent, selective, orally active, peptide-based fibrinogen receptor antagonists.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| HS Code | 2922498590 |
