A1304712
Boc-S-(4-methoxybenzyl)-L-cysteine , 98% , 18942-46-6
Synonym(s):
Boc-Cys(4-MeOBzl)-OH;N-α-t.-Boc-S-p-methoxybenzyl-L-cysteine
CAS NO.:18942-46-6
Empirical Formula: C16H23NO5S
Molecular Weight: 341.42
MDL number: MFCD00038254
EINECS: 242-695-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB53.60 | In Stock |
|
| 25G | RMB243.20 | In Stock |
|
| 100G | RMB1316.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 127~130℃ |
| Boiling point: | 514.0±50.0 °C(Predicted) |
| Density | 1.205±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Solid |
| pka | 3.57±0.10(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | -42.80°(C=0.01g/mL, DMSO, 20°C, 589nm) |
| Major Application | peptide synthesis |
| InChI | 1S/C16H23NO5S/c1-16(2,3)22-15(20)17-13(14(18)19)10-23-9-11-5-7-12(21-4)8-6-11/h5-8,13H,9-10H2,1-4H3,(H,17,20)(H,18,19) |
| InChIKey | VRTXRNJMNFVTOM-UHFFFAOYSA-N |
| SMILES | S(CC(NC(=O)OC(C)(C)C)C(=O)O)Cc1ccc(cc1)OC |
| CAS DataBase Reference | 18942-46-6(CAS DataBase Reference) |
| EPA Substance Registry System | L-Cysteine, N-[(1,1-dimethylethoxy)carbonyl]-S-[(4-methoxyphenyl)methyl]- (18942-46-6) |
Description and Uses
Boc-Cys(Mob)-OH, is a Cystine derivative, used in various chemical synthesis and peptide chemistry.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2930 90 16 |
| Storage Class | 11 - Combustible Solids |






