A7346012
Sulfisoxazole , 98% , 127-69-5
Synonym(s):
N1-(3,4-Dimethyl-5-isoxazolyl)sulfanilamide;4-Amino-N-(3,4-dimethyl-5-isoxazolyl)benzenesulfonamide;Sulfafurazole;Sulfisoxazole
CAS NO.:127-69-5
Empirical Formula: C11H13N3O3S
Molecular Weight: 267.3
MDL number: MFCD00003150
EINECS: 204-858-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB55.20 | In Stock |
|
| 5G | RMB175.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 195°C |
| Boiling point: | 482.2±55.0 °C(Predicted) |
| Density | 1.3486 (rough estimate) |
| refractive index | 1.6630 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | acetone: complete50 mg/ml |
| pka | 5.0(at 25℃) |
| form | Solid |
| color | White to Light Brown |
| Water Solubility | <0.1 g/100 mL at 22.5 ºC |
| λmax | 271nm(MeOH)(lit.) |
| Merck | 14,8952 |
| BRN | 6737262 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | 1S/C11H13N3O3S/c1-7-8(2)13-17-11(7)14-18(15,16)10-5-3-9(12)4-6-10/h3-6,14H,12H2,1-2H3 |
| InChIKey | NHUHCSRWZMLRLA-UHFFFAOYSA-N |
| SMILES | Cc1noc(NS(=O)(=O)c2ccc(N)cc2)c1C |
| CAS DataBase Reference | 127-69-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenesulfonamide, 4-amino-N-(3,4-dimethyl-5-isoxazolyl)-(127-69-5) |
| IARC | 3 (Vol. 24, Sup 7) 1987 |
| EPA Substance Registry System | Sulfisoxazole (127-69-5) |
Description and Uses
Sulfisoxazole is a sulfonamide based antibacterial that exhibits activity against wide spectrum of gram-negative and gram-positive bacterium.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| RTECS | WO9100000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29350030 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 127-69-5(Hazardous Substances Data) |
| Toxicity | LD50 orally in mice: 6800 mg/kg (Seki) |




