PRODUCT Properties
| Melting point: | >300°C |
| storage temp. | Inert atmosphere,Room Temperature |
| Appearance | White to off-white Solid |
| Water Solubility | Soluble in water. |
| InChI | InChI=1S/C2H3BrO2.Na.H/c3-1-2(4)5;;/h1H2,(H,4,5);; |
| InChIKey | OBGSCRKMRMZFGV-UHFFFAOYSA-N |
| SMILES | C(=O)(O)CBr.[NaH] |
| CAS DataBase Reference | 1068-52-6 |
Description and Uses
It is an important raw material and intermediate used in organic synthesis, agrochemical, pharmaceutical and dyestuff field.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P280a-P301+P310a-P305+P351+P338-P405-P501a |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 22-36/37/39-45 |
| RIDADR | 2811 |
| RTECS | AF6475000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
