A7379512
Methscopolamine Bromide , ≥98% , 155-41-9
Synonym(s):
(−)-Scopolamine methyl bromide;Hyoscine methyl bromide;Methscopolamine bromide
CAS NO.:155-41-9
Empirical Formula: C18H24BrNO4
Molecular Weight: 398.29
MDL number: MFCD00078560
EINECS: 205-844-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB215.20 | In Stock |
|
| 1G | RMB519.20 | In Stock |
|
| 5g | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 214-217 °C (decomp) |
| refractive index | -24 ° (C=1, H2O) |
| storage temp. | Store at -20°C |
| solubility | H2O: 50 mg/mL |
| form | powder |
| color | white |
| optical activity | [α]25/D 25°, c = 5 in H2O(lit.) |
| Water Solubility | H2O: 50mg/mL |
| Merck | 14,6003 |
| Stability: | Hygroscopic |
| InChIKey | CXYRUNPLKGGUJF-RAFJPFSSSA-M |
| SMILES | [Br-].[H][C@]12C[C@@H](C[C@]([H])([C@@]3([H])O[C@@]13[H])[N+]2(C)C)OC(=O)[C@H](CO)c4ccccc4 |
| CAS DataBase Reference | 155-41-9 |
| EPA Substance Registry System | 3-Oxa-9-azoniatricyclo[3.3.1.02,4]nonane, 7-[(2S)-3-hydroxy-1-oxo-2-phenylpropoxy]-9,9-dimethyl-, bromide (1:1), (1.alpha.,2.beta.,4.beta.,5.alpha.,7.beta.)- (155-41-9) |
Description and Uses
Methscopolamine bromide is the methylated derivative of Scopolamine, a muscarinic antagonist that is similar to acetylcholine. It have been used for the treatment of peptic ulcers by reducing acid secretion of the stomach and is used to treat morning sickness.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H312+H332-H400 |
| Precautionary statements | P261-P271-P273-P280-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | T,N,Xn |
| Risk Statements | 23/24/25-50/53-20/21/22-20/21 |
| Safety Statements | 36/37/39-45-61-60-36/37 |
| RIDADR | UN 1544 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | YM3675000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Aquatic Acute 1 |







