A7387112
Boc-β-phenyl-Phe-OH , ≥98.0% , 138662-63-2
Synonym(s):
N-(tert-Butoxycarbonyl)-β-phenyl-L -phenylalanine;Boc-β,β-diphenyl-Ala-OH;Boc-3,3-diphenyl-L -alanine
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB150.40 | In Stock |
|
| 1G | RMB395.20 | In Stock |
|
| 5G | RMB2020.80 | In Stock |
|
| 10g | RMB2088.80 | In Stock |
|
| 25g | RMB3501.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 160 °C (dec.)(lit.) |
| alpha | 29 º (c=1 in chloroform) |
| Boiling point: | 502.7±50.0 °C(Predicted) |
| Density | 1.167±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| pka | 3.68±0.10(Predicted) |
| form | solid |
| color | White |
| BRN | 4880641 |
| Major Application | peptide synthesis |
| InChI | 1S/C20H23NO4/c1-20(2,3)25-19(24)21-17(18(22)23)16(14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13,16-17H,1-3H3,(H,21,24)(H,22,23)/t17-/m0/s1 |
| InChIKey | TYJDOLCFYZSNQC-KRWDZBQOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C(c1ccccc1)c2ccccc2)C(O)=O |
| CAS DataBase Reference | 138662-63-2(CAS DataBase Reference) |
Description and Uses
Boc-L-3,3-diphenylalanine, is an alanine derivative used in chemical synthesis and peptide chemistry.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2922498590 |
| Storage Class | 11 - Combustible Solids |






