A7387512
S-Phenyl Benzenethiosulfonate , 98% , 1212-08-4
Synonym(s):
Benzenethiosulfonic acid S-phenyl ester
CAS NO.:1212-08-4
Empirical Formula: C12H10O2S2
Molecular Weight: 250.34
MDL number: MFCD00014738
EINECS: 214-919-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB114.40 | In Stock |
|
| 5G | RMB399.20 | In Stock |
|
| 25g | RMB1398.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 36-53 °C(lit.) |
| Boiling point: | 125 °C(Press: 0.01 Torr) |
| Density | 1.35±0.1 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Very Slightly) |
| form | Solid |
| color | Off-White |
| BRN | 1530592 |
| InChI | 1S/C12H10O2S2/c13-16(14,12-9-5-2-6-10-12)15-11-7-3-1-4-8-11/h1-10H |
| InChIKey | ATKJLMWDXASAJA-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Sc1ccccc1)c2ccccc2 |
| EPA Substance Registry System | Benzenesulfonothioic acid, S-phenyl ester (1212-08-4) |
Description and Uses
S-Phenyl Benzenethiosulfonate is an high potency antifungal thiosulfonate that were tested against Aspergillus niger and Aspergillus flavus.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |






