A7389612
S-(4-Nitrobenzyl)-6-thioinosine , ≥98% , 38048-32-7
Synonym(s):
6-[(4-Nitrobenzyl)thio]-9-β-D -ribofuranosylpurine;NBMPR;NBTI
CAS NO.:38048-32-7
Empirical Formula: C17H17N5O6S
Molecular Weight: 419.41
MDL number: MFCD00005745
EINECS: 253-753-4
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB340.80 | In Stock |
|
| 100MG | RMB1343.20 | In Stock |
|
| 250MG | RMB2676.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 187-190 °C(lit.) |
| Boiling point: | 770.2±70.0 °C(Predicted) |
| Density | 1.3904 (rough estimate) |
| refractive index | 1.6460 (estimate) |
| storage temp. | 2-8°C |
| solubility | 0.1 M HCl: slightly soluble |
| form | solid |
| pka | 13.08±0.70(Predicted) |
| color | white |
| InChIKey | DYCJFJRCWPVDHY-LSCFUAHRSA-N |
| SMILES | OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)n2cnc3c(SCc4ccc(cc4)[N+]([O-])=O)ncnc23 |
| CAS DataBase Reference | 38048-32-7(CAS DataBase Reference) |
Description and Uses
It is a prototype inhibitor of the human equilibrative nucleoside transporter (hENT1), and is a high affinity ligand with a Kd of 0.1-1.0 nM. Nucleoside transporter inhibitors have potential therapeutic applications as anticancer, antiviral, cardio
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | UO9025000 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |



