PRODUCT Properties
| Melting point: | 137-139 °C (lit.) |
| Boiling point: | 413.8±28.0 °C(Predicted) |
| Density | 1.384±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Water (Slightly) |
| form | Solid |
| pka | pK1:3.77;pK2:5.08 (25°C) |
| color | White to Off-White |
| Stability: | Light Sensitive |
| InChI | 1S/C5H6O4/c6-4(7)2-1-3-5(8)9/h1-2H,3H2,(H,6,7)(H,8,9)/b2-1+ |
| InChIKey | XVOUMQNXTGKGMA-OWOJBTEDSA-N |
| SMILES | [H]\C(CC(O)=O)=C(\[H])C(O)=O |
Description and Uses
trans-Glutaconic Acid is used in the synthesis of iso and azokainoids which act as agonists for glutamate receptors. E-isomer of Glutaconic Acid (G596945).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2917198090 |
| Storage Class | 11 - Combustible Solids |
