A7444712
(<i>S</i>)-(-)-Tetrahydrofuran-2-carboxylic Acid , >98.0%(GC) , 87392-07-2
CAS NO.：87392-07-2
Empirical Formula: C5H8O3
Molecular Weight: 116.12
MDL number: MFCD00272639
EINECS: 618-003-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB66.40 | In Stock |
|
| 5G | RMB175.20 | In Stock |
|
| 100g | RMB639.20 | In Stock |
|
| 25G | RMB696.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | -3 º (in MeOH) |
| Boiling point: | 244-251 °C(lit.) |
| Density | 1.2 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| pka | 3.60±0.20(Predicted) |
| color | Clear colorless to pale yellow |
| optical activity | [α]20/D 3° in methanol |
| BRN | 4658738 |
| InChI | InChI=1S/C5H8O3/c6-5(7)4-2-1-3-8-4/h4H,1-3H2,(H,6,7)/t4-/m0/s1 |
| InChIKey | UJJLJRQIPMGXEZ-BYPYZUCNSA-N |
| SMILES | O1CCC[C@H]1C(O)=O |
| CAS DataBase Reference | 87392-07-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P270-P280-P301+P312-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C,Xi |
| Risk Statements | 22-34-36/37/38 |
| Safety Statements | 26-36/37/39-45-36 |
| RIDADR | UN 3265 8/PG 3 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29321900 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
