A7533312
Stannous methanesulfonate , 50wt.%inH2O , 53408-94-9
Synonym(s):
Stannous methanesulfonate;Stannous methylsulfonate
CAS NO.：53408-94-9
Empirical Formula: C2H6O6S2Sn
Molecular Weight: 308.91
MDL number: MFCD00137737
EINECS: 401-640-7
| Pack Size | Price | Stock | Quantity |
| 100ML | RMB113.60 | In Stock |
|
| 250ML | RMB207.20 | In Stock |
|
| 500ML | RMB364.00 | In Stock |
|
| 2.5l | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -27°C |
| Density | 1.55 |
| refractive index | 1.444 |
| Specific Gravity | 1.550 |
| Water Solubility | Not miscible or difficult to mix in water. |
| Sensitive | Air Sensitive |
| Hydrolytic Sensitivity | 0: forms stable aqueous solutions |
| Exposure limits | ACGIH: TWA 0.1 mg/m3; STEL 0.2 mg/m3 (Skin) NIOSH: IDLH 25 mg/m3; TWA 0.1 mg/m3 |
| InChI | InChI=1S/2CH4O3S.Sn/c2*1-5(2,3)4;/h2*1H3,(H,2,3,4);/q;;+2/p-2 |
| InChIKey | JALQQBGHJJURDQ-UHFFFAOYSA-L |
| SMILES | S(=O)(=O)(C)[O-].S([O-])(=O)(=O)C.[Sn+2] |
| CAS DataBase Reference | 53408-94-9(CAS DataBase Reference) |
| EPA Substance Registry System | Methanesulfonic acid, tin(2+) salt (53408-94-9) |
Description and Uses
It is used in electroplating industry. Tin methanesulfonate is an aqueous solution used in the metal surface treatment. Mainly as a replacement for Tin sulfate where high speed deposits are needed (reel-to-reel).
Safety
| Symbol(GHS) |    GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H314-H317-H411 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C,N |
| Risk Statements | 22-34-43-51/53 |
| Safety Statements | 22-26-36/37/39-45-61 |
| RIDADR | UN 3265 |
| WGK Germany | 1 |
| TSCA | Yes |
| HazardClass | 8 |
