A7567858
Kaempferol3-β-D-glucopyranoside , 10mMinDMSO , 480-10-4
Synonym(s):
Astragalin;DDD;Kaempferol 3-glucoside;KRT5;KRT5A
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB792.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 223-229°C |
| Boiling point: | 823.2±65.0 °C(Predicted) |
| Density | 1.79±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; DMSO:PBS (pH 7.2) (1:6): 0.14 mg/ml |
| pka | 6.20±0.40(Predicted) |
| form | Solid |
| color | Yellow |
| biological source | mouse |
| InChIKey | JPUKWEQWGBDDQB-QSOFNFLRSA-N |
| SMILES | O=C1C(=C(C2C=CC(O)=CC=2)OC2=CC(O)=CC(O)=C12)O[C@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)O |&1:21,22,23,25,27,r| |
| LogP | 1.950 (est) |
| CAS DataBase Reference | 480-10-4(CAS DataBase Reference) |
Description and Uses
Astragaline is found in Erica multiflora leaf extract, which is used for mitigating high-?fat and high-?fructose diet (HFFD)?-?induced metabolic syndrome.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Safety Statements | 22 |
| WGK Germany | 3 |
| RTECS | DJ3080000 |
| HS Code | 29389090 |
