PRODUCT Properties
| Melting point: | 147 °C |
| Boiling point: | 191.38°C (rough estimate) |
| Density | 1.278 |
| refractive index | 1.5110 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Store in freezer, under -20°C |
| solubility | H2O: soluble50mg/mg protein |
| form | White to off-white powder. |
| pka | 14.36±0.40(Predicted) |
| color | White to Off-White |
| Water Solubility | H2O: 50mg/mg protein |
| BRN | 80799 |
| InChI | InChI=1S/C3H6N2O2/c4-2-1-7-5-3(2)6/h2H,1,4H2,(H,5,6)/t2-/m0/s1 |
| InChIKey | DYDCUQKUCUHJBH-REOHCLBHSA-N |
| SMILES | N[C@H]1CONC1=O |
| CAS DataBase Reference | 339-72-0(CAS DataBase Reference) |
Description and Uses
antibacterial, coccidiostat
Safety
| Symbol(GHS) |  GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P501-P240-P210-P233-P243-P241-P242-P280-P370+P378-P303+P361+P353-P403+P235 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 5-20 |
| Safety Statements | 38-36/37 |
| WGK Germany | 2 |
| RTECS | NY2976000 |
| F | 10 |
| Storage Class | 11 - Combustible Solids |
