A7589458
HypocrellinA , 10mMinDMSO , 77029-83-5
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 209-210 °C |
| Boiling point: | 922.8±65.0 °C(Predicted) |
| Density | 1.55±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMF: 2mg/mL; DMSO: 3mg/mL; Ethanol: 0.3mg/mL |
| form | A solid |
| pka | 7.03±0.60(Predicted) |
| color | Brown to red |
| InChIKey | URTOHKHBNYPGQJ-UHYDGBJBNA-N |
| SMILES | C12C3[C@@H](C(=O)C)[C@](O)(C)CC4=C(C(=O)C5=C(C=C(OC)C(C6C(OC)=CC(=O)C(=C(O)C=3OC)C1=6)=C5C=24)O)OC |&1:2,6,r| |
Description and Uses
Hypocrellin A is an antimicrobial and antileishmanial activity. Ga(3+)-Hypocrellin interacts with myoglobin in vitro.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
