M3139435
HYPOCRELLINB , Analysis of the control products,> 98%, derived from bamboo bacteria , 123940-54-5
CAS NO.：123940-54-5
Empirical Formula: C30H24O9
Molecular Weight: 528.51
MDL number: MFCD00467741
EINECS: 213-551-9
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB1200.00 | In Stock |
|
| 20mg | RMB3536.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 261-263℃ |
| Boiling point: | 893.8±65.0 °C(Predicted) |
| Density | 1.52±0.1 g/cm3 (20 ºC 760 Torr) |
| storage temp. | -20°C |
| solubility | DMF: soluble; DMSO: soluble |
| form | A crystalline solid |
| pka | 6.62±0.40(Predicted) |
| color | Brown to black |
| InChIKey | KPGRZWCQXQUGHK-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C3C4=C5C6C(=C(OC)C=C(O)C=62)C(OC)=CC5=C(O)C(=O)C(OC)=C4CC(C)=C3C(C(C)=O)=C1OC |
Description and Uses
Hypocrellin B is an apoptosis inducer.
