A7591858
Oxyresveratrol , 10mMinDMSO , 29700-22-9
Synonym(s):
(E)-2,3′,4,5′-Stilbenetetrol;2,3′,4,5′-Tetrahydroxy-trans-stilbene;4-[(1E)-2-(3,5-Dihydroxyphenyl)ethenyl]-1,3-benzenediol;Oxyresveratrol
CAS NO.:29700-22-9
Empirical Formula: C14H12O4
Molecular Weight: 244.24
MDL number: MFCD11974969
EINECS: 608-401-8
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 201-202.5 °C |
| Boiling point: | 523.8±30.0 °C(Predicted) |
| Density | 1.468±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Ethyl Acetate (Slightly), Methanol |
| pka | 9.14±0.10(Predicted) |
| form | Solid |
| color | Pale Yellow to Pale Beige |
| InChI | InChI=1S/C14H12O4/c15-11-4-3-10(14(18)8-11)2-1-9-5-12(16)7-13(17)6-9/h1-8,15-18H/b2-1+ |
| InChIKey | PDHAOJSHSJQANO-OWOJBTEDSA-N |
| SMILES | C1(O)=CC=C(/C=C/C2=CC(O)=CC(O)=C2)C(O)=C1 |
| CAS DataBase Reference | 29700-22-9(CAS DataBase Reference) |
Description and Uses
Oxyresveratrol is an effective tyrosinase inhibitor, and has anti-tussive and anti-asthmatic, antioxidant, anti-inflammatory and analgesic effects.
Oxyresveratrol is a natural hydroxystilbene with similar bioactivity to resveratrol. COX-1 inhibitor like resveratrol (R150000), anti-cancer agent.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P280-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26-24/25 |
| WGK Germany | 3 |
| HS Code | 29072990 |






