PRODUCT Properties
| Melting point: | 185℃ |
| Boiling point: | 411.3±40.0 °C(Predicted) |
| Density | 1.356±0.06 g/cm3(Predicted) |
| refractive index | -114 ° (C=4, H2O) |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility | Water (Slightly) |
| pka | 3.18±0.20(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | very faint turbidity |
| InChI | InChI=1S/C7H12N2O3/c8-4-6(10)9-3-1-2-5(9)7(11)12/h5H,1-4,8H2,(H,11,12)/t5-/m0/s1 |
| InChIKey | KZNQNBZMBZJQJO-YFKPBYRVSA-N |
| SMILES | C(O)(=O)[C@@H]1CCCN1C(=O)CN |
| CAS DataBase Reference | 704-15-4(CAS DataBase Reference) |
Description and Uses
Substrate for Prolidase.
