A7594458
7-Hydroxy-4-methyl-8-nitrocoumarin , 10mMinDMSO , 19037-69-5
CAS NO.：19037-69-5
Empirical Formula: C10H7NO5
Molecular Weight: 221.17
MDL number: MFCD00051824
EINECS: 622-633-7
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 254-259 °C (lit.) |
| solubility | DMF: 30 mg/ml; DMF:PBS (pH 7.2) (1:2): 0.33 mg/ml; DMSO: 10 mg/ml |
| form | A crystalline solid |
| color | Light yellow to light brown |
| BRN | 225171 |
| InChI | InChI=1S/C10H7NO5/c1-5-4-8(13)16-10-6(5)2-3-7(12)9(10)11(14)15/h2-4,12H,1H3 |
| InChIKey | BGUBUSIGKOWDPO-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=C([N+]([O-])=O)C(O)=CC=C2C(C)=C1 |
Description and Uses
7-Hydroxy-4-methyl-8-nitrocoumarin is a coumarin derivative[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317 |
| Precautionary statements | P280-P301+P312+P330-P302+P352 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-43-36/37/38 |
| Safety Statements | 36/37-36-26 |
| WGK Germany | 3 |
| HS Code | 2932209090 |
