A7597158
Mebrofenin , 10mMinDMSO , 78266-06-5
Synonym(s):
{{[(3-Bromomesityl)carbamoyl]methyl}imino}diacetic acid;N-{2-[(3-Bromo-2,4,6-trimethylphenyl)amino]-2-oxoethyl}-N-(carboxymethyl)glycine
CAS NO.:78266-06-5
Empirical Formula: C15H19BrN2O5
Molecular Weight: 387.23
MDL number: MFCD00216974
EINECS: 278-877-6
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 193-198 °C |
| Boiling point: | 577.4±50.0 °C(Predicted) |
| Density | 1.5766 (rough estimate) |
| refractive index | 1.6520 (estimate) |
| storage temp. | 2-8°C |
| pka | 1.68±0.10(Predicted) |
| form | Solid |
| color | White to off-white |
| Water Solubility | Soluble in dimethylsulphoxide and ethanol. Insoluble in water. |
| BRN | 10474727 |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C15H19BrN2O5/c1-8-4-9(2)15(10(3)14(8)16)17-11(19)5-18(6-12(20)21)7-13(22)23/h4H,5-7H2,1-3H3,(H,17,19)(H,20,21)(H,22,23) |
| InChIKey | MHPZZZZLAQGTHT-UHFFFAOYSA-N |
| SMILES | Brc1c(c(c(cc1C)C)NC(=O)CN(CC(=O)O)CC(=O)O)C |
Description and Uses
Diagnostic aid (hepatobiliary function determination).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | WGK 3 |
| RTECS | MB9121850 |
| HS Code | 2924296000 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 in mice, rats (mg/kg): 213.8, 226.4 i.v. (Jiang) |





