A7599558
Oxolaminecitratesalt , 10mMinDMSO , 1949-20-8
Synonym(s):
5-(2-[Diethylamino]ethyl)-3-phenyl-1,2,4-oxadiazole citrate salt;NSC 100298
CAS NO.：1949-20-8
Empirical Formula: C20H27N3O8
Molecular Weight: 437.44
MDL number: MFCD00083457
EINECS: 217-760-6
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 141-142 °C |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| color | Crystals. Sltly sol in water and alc |
| InChI | 1S/C14H19N3O.C6H8O7/c1-3-17(4-2)11-10-13-15-14(16-18-13)12-8-6-5-7-9-12;7-3(8)1-6(13,5(11)12)2-4(9)10/h5-9H,3-4,10-11H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | RBZIGQJSMCOHSS-UHFFFAOYSA-N |
| SMILES | OC(=O)CC(O)(CC(O)=O)C(O)=O.CCN(CC)CCc1nc(no1)-c2ccccc2 |
Description and Uses
Oxolamine Citrate, is a antiinflammatory drug used as a cough suppressant.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| RTECS | RO0720000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Toxicity | TDLo orl-rat: 15 g/kg/1Y-I:CAR EMPSAL 2,1,63 orl-rat LD50:1650 mg/kg BJPCAL 16,209,61 |
