PRODUCT Properties
| Melting point: | 148-150 °C(lit.) |
| Boiling point: | 469.7±28.0 °C(Predicted) |
| Density | 1.285±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly) |
| form | Solid |
| pka | 16.37±0.40(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C10H10N2O/c11-10(13)5-7-6-12-9-4-2-1-3-8(7)9/h1-4,6,12H,5H2,(H2,11,13) |
| InChIKey | ZOAMBXDOGPRZLP-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C(CC(N)=O)=C1 |
| CAS DataBase Reference | 879-37-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Indoleacetamide(879-37-8) |
Description and Uses
Indole-3-acetamide was used in the synthesis of [5.5.6.6]diazafenestrane skeleton and indole-3-acetic acid.
Reactant for the synthesis of:
PET agent for imaging of protein kinase C
A potential agent against Prion Disease
Protein kinase C (PKC) inhibitor bisindolylmaleimide IV
Glycogen synthase kinase-3 (GSK-3) inhibitors
Inhibitors of CaMKIId
A VEGF inhibitor
JAK3 inhibitors
Inhibitors of NAD+-Dependent Histone Deacetylases
Inhibitors of human adipocyte fatty acid-binding protein
Cyclin-dependent kinase inhibitors
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |




